C23H22ClF2NO3 — CID 3342104
2-(4-chloro-3-methylphenoxy)-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]propan-1-one (PubChem CID 3342104) has the molecular formula C23H22ClF2NO3 and a molecular weight of 433.88 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]propan-1-one.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 3342104 |
| Molecular Formula | C23H22ClF2NO3 |
| Molecular Weight | 433.88 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]propan-1-one |
| SMILES | Cc1cc(OC(C)C(=O)c2cc(C)n(-c3ccc(OC(F)F)cc3)c2C)ccc1Cl |
| InChI | InChI=1S/C23H22ClF2NO3/c1-13-11-19(9-10-21(13)24)29-16(4)22(28)20-12-14(2)27(15(20)3)17-5-7-18(8-6-17)30-23(25)26/h5-12,16,23H,1-4H3 |
| InChIKey | DEXIOHABHHAAHM-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.88 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|