C24H27F2N5O2 — CID 26570060
(2R)-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one (PubChem CID 26570060) has the molecular formula C24H27F2N5O2 and a molecular weight of 455.51 g/mol. Its IUPAC name is (2R)-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one.
| Compound Name | (2R)-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 26570060 |
| Molecular Formula | C24H27F2N5O2 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (2R)-1-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-(4-pyrimidin-2-ylpiperazin-1-yl)propan-1-one |
| SMILES | Cc1cc(C(=O)[C@@H](C)N2CCN(c3ncccn3)CC2)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C24H27F2N5O2/c1-16-15-21(17(2)31(16)19-5-7-20(8-6-19)33-23(25)26)22(32)18(3)29-11-13-30(14-12-29)24-27-9-4-10-28-24/h4-10,15,18,23H,11-14H2,1-3H3/t18-/m1/s1 |
| InChIKey | OCJFWEPAQMMPKY-GOSISDBHSA-N |
| XLogP | 3.88 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|