C19H19FN4O2 — CID 71943384
N-(1-amino-1-oxopropan-2-yl)-2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide (PubChem CID 71943384) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is N-(1-amino-1-oxopropan-2-yl)-2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide.
| Compound Name | N-(1-amino-1-oxopropan-2-yl)-2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 71943384 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-(1-amino-1-oxopropan-2-yl)-2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1cc(C=C(C#N)C(=O)NC(C)C(N)=O)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C19H19FN4O2/c1-11-8-14(9-15(10-21)19(26)23-12(2)18(22)25)13(3)24(11)17-7-5-4-6-16(17)20/h4-9,12H,1-3H3,(H2,22,25)(H,23,26) |
| InChIKey | VLASLBJZRJGSDF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|