C22H22FN5O3S2 — CID 170911926
(Z)-2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-[3-(2-methylpropylsulfonyl)-1,2,4-thiadiazol-5-yl]prop-2-enamide (PubChem CID 170911926) has the molecular formula C22H22FN5O3S2 and a molecular weight of 487.58 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-[3-(2-methylpropylsulfonyl)-1,2,4-thiadiazol-5-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-[3-(2-methylpropylsulfonyl)-1,2,4-thiadiazol-5-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170911926 |
| Molecular Formula | C22H22FN5O3S2 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | (Z)-2-cyano-3-[1-(2-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-[3-(2-methylpropylsulfonyl)-1,2,4-thiadiazol-5-yl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)Nc2nc(S(=O)(=O)CC(C)C)ns2)c(C)n1-c1ccccc1F |
| InChI | InChI=1S/C22H22FN5O3S2/c1-13(2)12-33(30,31)22-26-21(32-27-22)25-20(29)17(11-24)10-16-9-14(3)28(15(16)4)19-8-6-5-7-18(19)23/h5-10,13H,12H2,1-4H3,(H,25,26,27,29)/b17-10- |
| InChIKey | APKNYVJYUSCWMU-YVLHZVERSA-N |
| XLogP | 4.06 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|