C20H18ClN5O4S2 — CID 170910173
(Z)-3-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170910173) has the molecular formula C20H18ClN5O4S2 and a molecular weight of 491.98 g/mol. Its IUPAC name is (Z)-3-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-3-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170910173 |
| Molecular Formula | C20H18ClN5O4S2 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | (Z)-3-[1-(5-chloro-2-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1-n1c(C)cc(/C=C(/C#N)C(=O)Nc2nc(S(C)(=O)=O)ns2)c1C |
| InChI | InChI=1S/C20H18ClN5O4S2/c1-11-7-13(12(2)26(11)16-9-15(21)5-6-17(16)30-3)8-14(10-22)18(27)23-19-24-20(25-31-19)32(4,28)29/h5-9H,1-4H3,(H,23,24,25,27)/b14-8- |
| InChIKey | GALIGXPSWPWZGE-ZSOIEALJSA-N |
| XLogP | 3.56 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|