C18H14ClN5O4S2 — CID 171333217
3-[1-(3-chloro-4-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 171333217) has the molecular formula C18H14ClN5O4S2 and a molecular weight of 463.93 g/mol. Its IUPAC name is 3-[1-(3-chloro-4-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | 3-[1-(3-chloro-4-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171333217 |
| Molecular Formula | C18H14ClN5O4S2 |
| Molecular Weight | 463.93 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | 3-[1-(3-chloro-4-methoxyphenyl)pyrrol-2-yl]-2-cyano-N-(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | COc1ccc(-n2cccc2C=C(C#N)C(=O)Nc2nc(S(C)(=O)=O)ns2)cc1Cl |
| InChI | InChI=1S/C18H14ClN5O4S2/c1-28-15-6-5-13(9-14(15)19)24-7-3-4-12(24)8-11(10-20)16(25)21-17-22-18(23-29-17)30(2,26)27/h3-9H,1-2H3,(H,21,22,23,25) |
| InChIKey | WKMBYASFCIXYSM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.93 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|