C19H17N5O2S2 — CID 170915798
(Z)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[1-(4-methoxyphenyl)pyrrol-2-yl]prop-2-enamide (PubChem CID 170915798) has the molecular formula C19H17N5O2S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[1-(4-methoxyphenyl)pyrrol-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[1-(4-methoxyphenyl)pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170915798 |
| Molecular Formula | C19H17N5O2S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | (Z)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[1-(4-methoxyphenyl)pyrrol-2-yl]prop-2-enamide |
| SMILES | CCSc1nsc(NC(=O)/C(C#N)=C\c2cccn2-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C19H17N5O2S2/c1-3-27-19-22-18(28-23-19)21-17(25)13(12-20)11-15-5-4-10-24(15)14-6-8-16(26-2)9-7-14/h4-11H,3H2,1-2H3,(H,21,22,23,25)/b13-11- |
| InChIKey | PVBFOXBKFHOASZ-QBFSEMIESA-N |
| XLogP | 4.00 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|