C19H16ClN5OS — CID 171333069
3-[1-(4-chlorophenyl)pyrrol-2-yl]-2-cyano-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 171333069) has the molecular formula C19H16ClN5OS and a molecular weight of 397.89 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)pyrrol-2-yl]-2-cyano-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | 3-[1-(4-chlorophenyl)pyrrol-2-yl]-2-cyano-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171333069 |
| Molecular Formula | C19H16ClN5OS |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 3-[1-(4-chlorophenyl)pyrrol-2-yl]-2-cyano-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCCc1nnc(NC(=O)C(C#N)=Cc2cccn2-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C19H16ClN5OS/c1-2-4-17-23-24-19(27-17)22-18(26)13(12-21)11-16-5-3-10-25(16)15-8-6-14(20)7-9-15/h3,5-11H,2,4H2,1H3,(H,22,24,26) |
| InChIKey | FDZNZHLKUMOJDZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|