C21H21N5OS — CID 171333067
2-cyano-3-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 171333067) has the molecular formula C21H21N5OS and a molecular weight of 391.50 g/mol. Its IUPAC name is 2-cyano-3-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171333067 |
| Molecular Formula | C21H21N5OS |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-cyano-3-[1-(3,4-dimethylphenyl)pyrrol-2-yl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCCc1nnc(NC(=O)C(C#N)=Cc2cccn2-c2ccc(C)c(C)c2)s1 |
| InChI | InChI=1S/C21H21N5OS/c1-4-6-19-24-25-21(28-19)23-20(27)16(13-22)12-17-7-5-10-26(17)18-9-8-14(2)15(3)11-18/h5,7-12H,4,6H2,1-3H3,(H,23,25,27) |
| InChIKey | YBXIPXYYXMQZLV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|