C20H17ClN6O3S — CID 171333095
N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[1-(2-chloro-4-nitrophenyl)pyrrol-2-yl]-2-cyanoprop-2-enamide (PubChem CID 171333095) has the molecular formula C20H17ClN6O3S and a molecular weight of 456.92 g/mol. Its IUPAC name is N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[1-(2-chloro-4-nitrophenyl)pyrrol-2-yl]-2-cyanoprop-2-enamide.
| Compound Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[1-(2-chloro-4-nitrophenyl)pyrrol-2-yl]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 171333095 |
| Molecular Formula | C20H17ClN6O3S |
| Molecular Weight | 456.92 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | N-(5-butyl-1,3,4-thiadiazol-2-yl)-3-[1-(2-chloro-4-nitrophenyl)pyrrol-2-yl]-2-cyanoprop-2-enamide |
| SMILES | CCCCc1nnc(NC(=O)C(C#N)=Cc2cccn2-c2ccc([N+](=O)[O-])cc2Cl)s1 |
| InChI | InChI=1S/C20H17ClN6O3S/c1-2-3-6-18-24-25-20(31-18)23-19(28)13(12-22)10-14-5-4-9-26(14)17-8-7-15(27(29)30)11-16(17)21/h4-5,7-11H,2-3,6H2,1H3,(H,23,25,28) |
| InChIKey | OMGXKWIUBNIOBW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.92 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|