C22H23N5OS — CID 170914833
(Z)-2-cyano-3-[1-(2-ethyl-6-methylphenyl)pyrrol-2-yl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170914833) has the molecular formula C22H23N5OS and a molecular weight of 405.53 g/mol. Its IUPAC name is (Z)-2-cyano-3-[1-(2-ethyl-6-methylphenyl)pyrrol-2-yl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[1-(2-ethyl-6-methylphenyl)pyrrol-2-yl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170914833 |
| Molecular Formula | C22H23N5OS |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | (Z)-2-cyano-3-[1-(2-ethyl-6-methylphenyl)pyrrol-2-yl]-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCCc1nnc(NC(=O)/C(C#N)=C\c2cccn2-c2c(C)cccc2CC)s1 |
| InChI | InChI=1S/C22H23N5OS/c1-4-8-19-25-26-22(29-19)24-21(28)17(14-23)13-18-11-7-12-27(18)20-15(3)9-6-10-16(20)5-2/h6-7,9-13H,4-5,8H2,1-3H3,(H,24,26,28)/b17-13- |
| InChIKey | PTOJTCOFFBNRGU-LGMDPLHJSA-N |
| XLogP | 4.70 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|