C15H14N4OS — CID 170916518
(Z)-2-cyano-3-phenyl-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170916518) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is (Z)-2-cyano-3-phenyl-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-phenyl-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170916518 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (Z)-2-cyano-3-phenyl-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCCc1nnc(NC(=O)/C(C#N)=C\c2ccccc2)s1 |
| InChI | InChI=1S/C15H14N4OS/c1-2-6-13-18-19-15(21-13)17-14(20)12(10-16)9-11-7-4-3-5-8-11/h3-5,7-9H,2,6H2,1H3,(H,17,19,20)/b12-9- |
| InChIKey | HGVUYZXLHMOOCQ-XFXZXTDPSA-N |
| XLogP | 3.04 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|