C13H12N4OS2 — CID 170917046
(Z)-2-cyano-N-(5-propyl-1,3,4-thiadiazol-2-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 170917046) has the molecular formula C13H12N4OS2 and a molecular weight of 304.40 g/mol. Its IUPAC name is (Z)-2-cyano-N-(5-propyl-1,3,4-thiadiazol-2-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(5-propyl-1,3,4-thiadiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 170917046 |
| Molecular Formula | C13H12N4OS2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | (Z)-2-cyano-N-(5-propyl-1,3,4-thiadiazol-2-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCCc1nnc(NC(=O)/C(C#N)=C\c2cccs2)s1 |
| InChI | InChI=1S/C13H12N4OS2/c1-2-4-11-16-17-13(20-11)15-12(18)9(8-14)7-10-5-3-6-19-10/h3,5-7H,2,4H2,1H3,(H,15,17,18)/b9-7- |
| InChIKey | ZPLGRGYBODLDOH-CLFYSBASSA-N |
| XLogP | 3.10 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|