C12H10N4OS3 — CID 170916221
(Z)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-thiophen-2-ylprop-2-enamide (PubChem CID 170916221) has the molecular formula C12H10N4OS3 and a molecular weight of 322.44 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 170916221 |
| Molecular Formula | C12H10N4OS3 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | (Z)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCSc1nsc(NC(=O)/C(C#N)=C\c2cccs2)n1 |
| InChI | InChI=1S/C12H10N4OS3/c1-2-18-12-15-11(20-16-12)14-10(17)8(7-13)6-9-4-3-5-19-9/h3-6H,2H2,1H3,(H,14,15,16,17)/b8-6- |
| InChIKey | OACQTRSUZXVTOW-VURMDHGXSA-N |
| XLogP | 3.26 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|