C17H14N4O3S3 — CID 170918619
(Z)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[5-(furan-2-ylmethylsulfanyl)furan-2-yl]prop-2-enamide (PubChem CID 170918619) has the molecular formula C17H14N4O3S3 and a molecular weight of 418.53 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[5-(furan-2-ylmethylsulfanyl)furan-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[5-(furan-2-ylmethylsulfanyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170918619 |
| Molecular Formula | C17H14N4O3S3 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | (Z)-2-cyano-N-(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)-3-[5-(furan-2-ylmethylsulfanyl)furan-2-yl]prop-2-enamide |
| SMILES | CCSc1nsc(NC(=O)/C(C#N)=C\c2ccc(SCc3ccco3)o2)n1 |
| InChI | InChI=1S/C17H14N4O3S3/c1-2-25-17-20-16(27-21-17)19-15(22)11(9-18)8-12-5-6-14(24-12)26-10-13-4-3-7-23-13/h3-8H,2,10H2,1H3,(H,19,20,21,22)/b11-8- |
| InChIKey | KNSRLECLRIGEPP-FLIBITNWSA-N |
| XLogP | 4.67 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|