C16H12N4O3S3 — CID 171333528
2-cyano-3-[5-(furan-2-ylmethylsulfanyl)furan-2-yl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 171333528) has the molecular formula C16H12N4O3S3 and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-cyano-3-[5-(furan-2-ylmethylsulfanyl)furan-2-yl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | 2-cyano-3-[5-(furan-2-ylmethylsulfanyl)furan-2-yl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 171333528 |
| Molecular Formula | C16H12N4O3S3 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 2-cyano-3-[5-(furan-2-ylmethylsulfanyl)furan-2-yl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CSc1nsc(NC(=O)C(C#N)=Cc2ccc(SCc3ccco3)o2)n1 |
| InChI | InChI=1S/C16H12N4O3S3/c1-24-16-19-15(26-20-16)18-14(21)10(8-17)7-11-4-5-13(23-11)25-9-12-3-2-6-22-12/h2-7H,9H2,1H3,(H,18,19,20,21) |
| InChIKey | MLGCADKVYZHXQQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|