C19H14N4O4S2 — CID 171331777
methyl 4-[5-[2-cyano-3-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate (PubChem CID 171331777) has the molecular formula C19H14N4O4S2 and a molecular weight of 426.48 g/mol. Its IUPAC name is methyl 4-[5-[2-cyano-3-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[2-cyano-3-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 171331777 |
| Molecular Formula | C19H14N4O4S2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | methyl 4-[5-[2-cyano-3-[(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C=C(C#N)C(=O)Nc3nc(SC)ns3)o2)cc1 |
| InChI | InChI=1S/C19H14N4O4S2/c1-26-17(25)12-5-3-11(4-6-12)15-8-7-14(27-15)9-13(10-20)16(24)21-18-22-19(28-2)23-29-18/h3-9H,1-2H3,(H,21,22,23,24) |
| InChIKey | YOQVHOQBAZTHHH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|