C18H13N5O4S2 — CID 170918391
(Z)-2-cyano-3-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide (PubChem CID 170918391) has the molecular formula C18H13N5O4S2 and a molecular weight of 427.47 g/mol. Its IUPAC name is (Z)-2-cyano-3-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170918391 |
| Molecular Formula | C18H13N5O4S2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | (Z)-2-cyano-3-[5-(2-methyl-5-nitrophenyl)furan-2-yl]-N-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)prop-2-enamide |
| SMILES | CSc1nsc(NC(=O)/C(C#N)=C\c2ccc(-c3cc([N+](=O)[O-])ccc3C)o2)n1 |
| InChI | InChI=1S/C18H13N5O4S2/c1-10-3-4-12(23(25)26)8-14(10)15-6-5-13(27-15)7-11(9-19)16(24)20-17-21-18(28-2)22-29-17/h3-8H,1-2H3,(H,20,21,22,24)/b11-7- |
| InChIKey | RPXBUXUPWRMEEA-XFFZJAGNSA-N |
| XLogP | 4.28 |
| TPSA | 134.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|