C23H21N5O4S — CID 170918850
(Z)-2-cyano-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-[5-(2-methyl-5-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 170918850) has the molecular formula C23H21N5O4S and a molecular weight of 463.52 g/mol. Its IUPAC name is (Z)-2-cyano-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-[5-(2-methyl-5-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-[5-(2-methyl-5-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 170918850 |
| Molecular Formula | C23H21N5O4S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | (Z)-2-cyano-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-[5-(2-methyl-5-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1ccc(/C=C(/C#N)C(=O)Nc2nnc(C3CCCCC3)s2)o1 |
| InChI | InChI=1S/C23H21N5O4S/c1-14-7-8-17(28(30)31)12-19(14)20-10-9-18(32-20)11-16(13-24)21(29)25-23-27-26-22(33-23)15-5-3-2-4-6-15/h7-12,15H,2-6H2,1H3,(H,25,27,29)/b16-11- |
| InChIKey | LUCMSXIUTKGZEO-WJDWOHSUSA-N |
| XLogP | 5.61 |
| TPSA | 134.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|