C23H20N4O4S — CID 170918557
3-[5-[(Z)-2-cyano-3-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]furan-2-yl]benzoic acid (PubChem CID 170918557) has the molecular formula C23H20N4O4S and a molecular weight of 448.50 g/mol. Its IUPAC name is 3-[5-[(Z)-2-cyano-3-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(Z)-2-cyano-3-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 170918557 |
| Molecular Formula | C23H20N4O4S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 3-[5-[(Z)-2-cyano-3-[(5-cyclohexyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]furan-2-yl]benzoic acid |
| SMILES | N#C/C(=C/c1ccc(-c2cccc(C(=O)O)c2)o1)C(=O)Nc1nnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C23H20N4O4S/c24-13-17(20(28)25-23-27-26-21(32-23)14-5-2-1-3-6-14)12-18-9-10-19(31-18)15-7-4-8-16(11-15)22(29)30/h4,7-12,14H,1-3,5-6H2,(H,29,30)(H,25,27,28)/b17-12- |
| InChIKey | WUAJZNJMAJGKET-ATVHPVEESA-N |
| XLogP | 5.09 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|