C18H17FN4OS — CID 170918554
(Z)-2-cyano-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 170918554) has the molecular formula C18H17FN4OS and a molecular weight of 356.43 g/mol. Its IUPAC name is (Z)-2-cyano-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 170918554 |
| Molecular Formula | C18H17FN4OS |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (Z)-2-cyano-N-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(F)cc1)C(=O)Nc1nnc(C2CCCCC2)s1 |
| InChI | InChI=1S/C18H17FN4OS/c19-15-8-6-12(7-9-15)10-14(11-20)16(24)21-18-23-22-17(25-18)13-4-2-1-3-5-13/h6-10,13H,1-5H2,(H,21,23,24)/b14-10- |
| InChIKey | NLWLBZLWKNOUFN-UVTDQMKNSA-N |
| XLogP | 4.27 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|