C22H26N4O3S — CID 19227203
(E)-2-cyano-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 19227203) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is (E)-2-cyano-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19227203 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (E)-2-cyano-N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCOc1ccc(/C=C(\C#N)C(=O)Nc2nnc(C3CC3)s2)cc1OC |
| InChI | InChI=1S/C22H26N4O3S/c1-3-4-5-6-11-29-18-10-7-15(13-19(18)28-2)12-17(14-23)20(27)24-22-26-25-21(30-22)16-8-9-16/h7,10,12-13,16H,3-6,8-9,11H2,1-2H3,(H,24,26,27)/b17-12+ |
| InChIKey | YDZZWOHMICHUGW-SFQUDFHCSA-N |
| XLogP | 4.93 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|