C27H28ClN3O3S — CID 19195472
(E)-N-[4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide (PubChem CID 19195472) has the molecular formula C27H28ClN3O3S and a molecular weight of 510.06 g/mol. Its IUPAC name is (E)-N-[4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19195472 |
| Molecular Formula | C27H28ClN3O3S |
| Molecular Weight | 510.06 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | (E)-N-[4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCOc1ccc(/C=C(\C#N)C(=O)Nc2nc(-c3cccc(Cl)c3)c(C)s2)cc1OC |
| InChI | InChI=1S/C27H28ClN3O3S/c1-4-5-6-7-13-34-23-12-11-19(15-24(23)33-3)14-21(17-29)26(32)31-27-30-25(18(2)35-27)20-9-8-10-22(28)16-20/h8-12,14-16H,4-7,13H2,1-3H3,(H,30,31,32)/b21-14+ |
| InChIKey | OWAYQGOARUQQTI-KGENOOAVSA-N |
| XLogP | 7.29 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.06 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|