C21H16ClN3O2S — CID 19195587
(E)-N-[4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-cyano-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 19195587) has the molecular formula C21H16ClN3O2S and a molecular weight of 409.90 g/mol. Its IUPAC name is (E)-N-[4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-cyano-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-cyano-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19195587 |
| Molecular Formula | C21H16ClN3O2S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | (E)-N-[4-(3-chlorophenyl)-5-methyl-1,3-thiazol-2-yl]-2-cyano-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1/C=C(\C#N)C(=O)Nc1nc(-c2cccc(Cl)c2)c(C)s1 |
| InChI | InChI=1S/C21H16ClN3O2S/c1-13-19(15-7-5-8-17(22)11-15)24-21(28-13)25-20(26)16(12-23)10-14-6-3-4-9-18(14)27-2/h3-11H,1-2H3,(H,24,25,26)/b16-10+ |
| InChIKey | UJTQLCXTIIQIIS-MHWRWJLKSA-N |
| XLogP | 5.33 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|