C20H17N3O2S — CID 19227363
(E)-2-cyano-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 19227363) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is (E)-2-cyano-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19227363 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (E)-2-cyano-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1/C=C(\C#N)C(=O)Nc1nc2c(C)cc(C)cc2s1 |
| InChI | InChI=1S/C20H17N3O2S/c1-12-8-13(2)18-17(9-12)26-20(22-18)23-19(24)15(11-21)10-14-6-4-5-7-16(14)25-3/h4-10H,1-3H3,(H,22,23,24)/b15-10+ |
| InChIKey | DSJTYSBEJFVXOC-XNTDXEJSSA-N |
| XLogP | 4.47 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|