C19H19N3O3S2 — CID 19631072
N-[(4,6-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]-2,6-dimethoxybenzamide (PubChem CID 19631072) has the molecular formula C19H19N3O3S2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-[(4,6-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[(4,6-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 19631072 |
| Molecular Formula | C19H19N3O3S2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-[(4,6-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)NC(=S)Nc1nc2c(C)cc(C)cc2s1 |
| InChI | InChI=1S/C19H19N3O3S2/c1-10-8-11(2)16-14(9-10)27-19(20-16)22-18(26)21-17(23)15-12(24-3)6-5-7-13(15)25-4/h5-9H,1-4H3,(H2,20,21,22,23,26) |
| InChIKey | JZVSDDHBPOCJMJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|