C17H13BrClN3OS2 — CID 17104567
5-bromo-2-chloro-N-[(4,6-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 17104567) has the molecular formula C17H13BrClN3OS2 and a molecular weight of 454.80 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(4,6-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[(4,6-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17104567 |
| Molecular Formula | C17H13BrClN3OS2 |
| Molecular Weight | 454.80 g/mol |
| Exact Mass | 452.94 |
| IUPAC Name | 5-bromo-2-chloro-N-[(4,6-dimethyl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | Cc1cc(C)c2nc(NC(=S)NC(=O)c3cc(Br)ccc3Cl)sc2c1 |
| InChI | InChI=1S/C17H13BrClN3OS2/c1-8-5-9(2)14-13(6-8)25-17(20-14)22-16(24)21-15(23)11-7-10(18)3-4-12(11)19/h3-7H,1-2H3,(H2,20,21,22,23,24) |
| InChIKey | QWQXAEUBWCWQRM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.80 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|