C16H12ClIN2OS — CID 5218207
2-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-iodobenzamide (PubChem CID 5218207) has the molecular formula C16H12ClIN2OS and a molecular weight of 442.71 g/mol. Its IUPAC name is 2-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-iodobenzamide.
| Compound Name | 2-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-iodobenzamide |
|---|---|
| PubChem CID | 5218207 |
| Molecular Formula | C16H12ClIN2OS |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 441.94 |
| IUPAC Name | 2-chloro-N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-iodobenzamide |
| SMILES | Cc1cc(C)c2nc(NC(=O)c3cc(I)ccc3Cl)sc2c1 |
| InChI | InChI=1S/C16H12ClIN2OS/c1-8-5-9(2)14-13(6-8)22-16(19-14)20-15(21)11-7-10(18)3-4-12(11)17/h3-7H,1-2H3,(H,19,20,21) |
| InChIKey | PMESVMXOKLJLML-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|