C15H11ClINS — CID 95909837
2-(2-chloro-5-iodophenyl)-4,6-dimethyl-1,3-benzothiazole (PubChem CID 95909837) has the molecular formula C15H11ClINS and a molecular weight of 399.68 g/mol. Its IUPAC name is 2-(2-chloro-5-iodophenyl)-4,6-dimethyl-1,3-benzothiazole.
| Compound Name | 2-(2-chloro-5-iodophenyl)-4,6-dimethyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 95909837 |
| Molecular Formula | C15H11ClINS |
| Molecular Weight | 399.68 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | 2-(2-chloro-5-iodophenyl)-4,6-dimethyl-1,3-benzothiazole |
| SMILES | Cc1cc(C)c2nc(-c3cc(I)ccc3Cl)sc2c1 |
| InChI | InChI=1S/C15H11ClINS/c1-8-5-9(2)14-13(6-8)19-15(18-14)11-7-10(17)3-4-12(11)16/h3-7H,1-2H3 |
| InChIKey | VEMQXCUFDQMZGU-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.68 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|