C10H8F3NS — CID 84626504
4,6-dimethyl-2-(trifluoromethyl)-1,3-benzothiazole (PubChem CID 84626504) has the molecular formula C10H8F3NS and a molecular weight of 231.24 g/mol. Its IUPAC name is 4,6-dimethyl-2-(trifluoromethyl)-1,3-benzothiazole.
| Compound Name | 4,6-dimethyl-2-(trifluoromethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 84626504 |
| Molecular Formula | C10H8F3NS |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.03 |
| IUPAC Name | 4,6-dimethyl-2-(trifluoromethyl)-1,3-benzothiazole |
| SMILES | Cc1cc(C)c2nc(C(F)(F)F)sc2c1 |
| InChI | InChI=1S/C10H8F3NS/c1-5-3-6(2)8-7(4-5)15-9(14-8)10(11,12)13/h3-4H,1-2H3 |
| InChIKey | GYKCIOKIPONCCB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |