C11H14N2OS — CID 605706
2-[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]ethanol (PubChem CID 605706) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]ethanol.
| Compound Name | 2-[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]ethanol |
|---|---|
| PubChem CID | 605706 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-[(4,6-dimethyl-1,3-benzothiazol-2-yl)amino]ethanol |
| SMILES | Cc1cc(C)c2nc(NCCO)sc2c1 |
| InChI | InChI=1S/C11H14N2OS/c1-7-5-8(2)10-9(6-7)15-11(13-10)12-3-4-14/h5-6,14H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | CMMUJIHBIYWZGP-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |