C16H12ClIN2O3S — CID 5023943
2-chloro-N-(4,6-dimethoxy-1,3-benzothiazol-2-yl)-5-iodobenzamide (PubChem CID 5023943) has the molecular formula C16H12ClIN2O3S and a molecular weight of 474.71 g/mol. Its IUPAC name is 2-chloro-N-(4,6-dimethoxy-1,3-benzothiazol-2-yl)-5-iodobenzamide.
| Compound Name | 2-chloro-N-(4,6-dimethoxy-1,3-benzothiazol-2-yl)-5-iodobenzamide |
|---|---|
| PubChem CID | 5023943 |
| Molecular Formula | C16H12ClIN2O3S |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 473.93 |
| IUPAC Name | 2-chloro-N-(4,6-dimethoxy-1,3-benzothiazol-2-yl)-5-iodobenzamide |
| SMILES | COc1cc(OC)c2nc(NC(=O)c3cc(I)ccc3Cl)sc2c1 |
| InChI | InChI=1S/C16H12ClIN2O3S/c1-22-9-6-12(23-2)14-13(7-9)24-16(19-14)20-15(21)10-5-8(18)3-4-11(10)17/h3-7H,1-2H3,(H,19,20,21) |
| InChIKey | GOXFDDSDMWLOIF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|