C17H13BrClN3O3S2 — CID 3309801
5-bromo-2-chloro-N-[(4,6-dimethoxy-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 3309801) has the molecular formula C17H13BrClN3O3S2 and a molecular weight of 486.80 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(4,6-dimethoxy-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[(4,6-dimethoxy-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3309801 |
| Molecular Formula | C17H13BrClN3O3S2 |
| Molecular Weight | 486.80 g/mol |
| Exact Mass | 484.93 |
| IUPAC Name | 5-bromo-2-chloro-N-[(4,6-dimethoxy-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | COc1cc(OC)c2nc(NC(=S)NC(=O)c3cc(Br)ccc3Cl)sc2c1 |
| InChI | InChI=1S/C17H13BrClN3O3S2/c1-24-9-6-12(25-2)14-13(7-9)27-17(20-14)22-16(26)21-15(23)10-5-8(18)3-4-11(10)19/h3-7H,1-2H3,(H2,20,21,22,23,26) |
| InChIKey | SHSIYNZXEAREEB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.80 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|