C17H11BrClN3O3S2 — CID 17128932
methyl 2-[(5-bromo-2-chlorobenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate (PubChem CID 17128932) has the molecular formula C17H11BrClN3O3S2 and a molecular weight of 484.78 g/mol. Its IUPAC name is methyl 2-[(5-bromo-2-chlorobenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-[(5-bromo-2-chlorobenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 17128932 |
| Molecular Formula | C17H11BrClN3O3S2 |
| Molecular Weight | 484.78 g/mol |
| Exact Mass | 482.91 |
| IUPAC Name | methyl 2-[(5-bromo-2-chlorobenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(NC(=S)NC(=O)c3cc(Br)ccc3Cl)sc2c1 |
| InChI | InChI=1S/C17H11BrClN3O3S2/c1-25-15(24)8-2-5-12-13(6-8)27-17(20-12)22-16(26)21-14(23)10-7-9(18)3-4-11(10)19/h2-7H,1H3,(H2,20,21,22,23,26) |
| InChIKey | VDXWWPGPOQQGOF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.78 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|