C16H11Br2N3O3S2 — CID 21167210
3,5-dibromo-N-[(6-hydroxy-1,3-benzothiazol-2-yl)carbamothioyl]-2-methoxybenzamide (PubChem CID 21167210) has the molecular formula C16H11Br2N3O3S2 and a molecular weight of 517.22 g/mol. Its IUPAC name is 3,5-dibromo-N-[(6-hydroxy-1,3-benzothiazol-2-yl)carbamothioyl]-2-methoxybenzamide.
| Compound Name | 3,5-dibromo-N-[(6-hydroxy-1,3-benzothiazol-2-yl)carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 21167210 |
| Molecular Formula | C16H11Br2N3O3S2 |
| Molecular Weight | 517.22 g/mol |
| Exact Mass | 514.86 |
| IUPAC Name | 3,5-dibromo-N-[(6-hydroxy-1,3-benzothiazol-2-yl)carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1c(Br)cc(Br)cc1C(=O)NC(=S)Nc1nc2ccc(O)cc2s1 |
| InChI | InChI=1S/C16H11Br2N3O3S2/c1-24-13-9(4-7(17)5-10(13)18)14(23)20-15(25)21-16-19-11-3-2-8(22)6-12(11)26-16/h2-6,22H,1H3,(H2,19,20,21,23,25) |
| InChIKey | WQXWANPTWSFZFK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.22 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|