C14H11IN2OS2 — CID 79693774
N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-iodothiophene-3-carboxamide (PubChem CID 79693774) has the molecular formula C14H11IN2OS2 and a molecular weight of 414.29 g/mol. Its IUPAC name is N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-iodothiophene-3-carboxamide.
| Compound Name | N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-iodothiophene-3-carboxamide |
|---|---|
| PubChem CID | 79693774 |
| Molecular Formula | C14H11IN2OS2 |
| Molecular Weight | 414.29 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-5-iodothiophene-3-carboxamide |
| SMILES | Cc1cc(C)c2nc(NC(=O)c3csc(I)c3)sc2c1 |
| InChI | InChI=1S/C14H11IN2OS2/c1-7-3-8(2)12-10(4-7)20-14(16-12)17-13(18)9-5-11(15)19-6-9/h3-6H,1-2H3,(H,16,17,18) |
| InChIKey | MLPHOTPFXJEJEN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.29 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|