C24H22N2OS — CID 19226196
N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(2-phenylethyl)benzamide (PubChem CID 19226196) has the molecular formula C24H22N2OS and a molecular weight of 386.52 g/mol. Its IUPAC name is N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(2-phenylethyl)benzamide.
| Compound Name | N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 19226196 |
| Molecular Formula | C24H22N2OS |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-(4,6-dimethyl-1,3-benzothiazol-2-yl)-2-(2-phenylethyl)benzamide |
| SMILES | Cc1cc(C)c2nc(NC(=O)c3ccccc3CCc3ccccc3)sc2c1 |
| InChI | InChI=1S/C24H22N2OS/c1-16-14-17(2)22-21(15-16)28-24(25-22)26-23(27)20-11-7-6-10-19(20)13-12-18-8-4-3-5-9-18/h3-11,14-15H,12-13H2,1-2H3,(H,25,26,27) |
| InChIKey | PLABOORSZIXSEP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |