C27H30N4O4S — CID 170910587
(Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[4-[2-(2,6-dimethylphenoxy)ethoxy]-3-methoxyphenyl]prop-2-enamide (PubChem CID 170910587) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is (Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[4-[2-(2,6-dimethylphenoxy)ethoxy]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[4-[2-(2,6-dimethylphenoxy)ethoxy]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 170910587 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | (Z)-N-(5-butyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[4-[2-(2,6-dimethylphenoxy)ethoxy]-3-methoxyphenyl]prop-2-enamide |
| SMILES | CCCCc1nnc(NC(=O)/C(C#N)=C\c2ccc(OCCOc3c(C)cccc3C)c(OC)c2)s1 |
| InChI | InChI=1S/C27H30N4O4S/c1-5-6-10-24-30-31-27(36-24)29-26(32)21(17-28)15-20-11-12-22(23(16-20)33-4)34-13-14-35-25-18(2)8-7-9-19(25)3/h7-9,11-12,15-16H,5-6,10,13-14H2,1-4H3,(H,29,31,32)/b21-15- |
| InChIKey | LLHVOBQJGKSVAK-QNGOZBTKSA-N |
| XLogP | 5.51 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|