C27H30N4O4S — CID 11191381
(E)-N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[4-[2-(2,6-dimethylphenoxy)ethoxy]-3-methoxyphenyl]prop-2-enamide (PubChem CID 11191381) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is (E)-N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[4-[2-(2,6-dimethylphenoxy)ethoxy]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (E)-N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[4-[2-(2,6-dimethylphenoxy)ethoxy]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 11191381 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | (E)-N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-cyano-3-[4-[2-(2,6-dimethylphenoxy)ethoxy]-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2nnc(C(C)(C)C)s2)ccc1OCCOc1c(C)cccc1C |
| InChI | InChI=1S/C27H30N4O4S/c1-17-8-7-9-18(2)23(17)35-13-12-34-21-11-10-19(15-22(21)33-6)14-20(16-28)24(32)29-26-31-30-25(36-26)27(3,4)5/h7-11,14-15H,12-13H2,1-6H3,(H,29,31,32)/b20-14+ |
| InChIKey | PUYORRFYMDYWPL-XSFVSMFZSA-N |
| XLogP | 5.46 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|