C27H30N4O5S — CID 170917736
(Z)-2-cyano-3-[3-methoxy-4-[2-[2-(2-methylphenoxy)ethoxy]ethoxy]phenyl]-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170917736) has the molecular formula C27H30N4O5S and a molecular weight of 522.63 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-methoxy-4-[2-[2-(2-methylphenoxy)ethoxy]ethoxy]phenyl]-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-methoxy-4-[2-[2-(2-methylphenoxy)ethoxy]ethoxy]phenyl]-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170917736 |
| Molecular Formula | C27H30N4O5S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | (Z)-2-cyano-3-[3-methoxy-4-[2-[2-(2-methylphenoxy)ethoxy]ethoxy]phenyl]-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2nnc(C(C)C)s2)ccc1OCCOCCOc1ccccc1C |
| InChI | InChI=1S/C27H30N4O5S/c1-18(2)26-30-31-27(37-26)29-25(32)21(17-28)15-20-9-10-23(24(16-20)33-4)36-14-12-34-11-13-35-22-8-6-5-7-19(22)3/h5-10,15-16,18H,11-14H2,1-4H3,(H,29,31,32)/b21-15- |
| InChIKey | FMCFLRLUMOMZJV-QNGOZBTKSA-N |
| XLogP | 5.00 |
| TPSA | 115.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|