C28H32N4O5S — CID 170916881
(Z)-2-cyano-3-[4-[2-[2-(3,4-dimethylphenoxy)ethoxy]ethoxy]-3-methoxyphenyl]-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170916881) has the molecular formula C28H32N4O5S and a molecular weight of 536.65 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[2-[2-(3,4-dimethylphenoxy)ethoxy]ethoxy]-3-methoxyphenyl]-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[2-[2-(3,4-dimethylphenoxy)ethoxy]ethoxy]-3-methoxyphenyl]-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170916881 |
| Molecular Formula | C28H32N4O5S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | (Z)-2-cyano-3-[4-[2-[2-(3,4-dimethylphenoxy)ethoxy]ethoxy]-3-methoxyphenyl]-N-(5-propan-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2nnc(C(C)C)s2)ccc1OCCOCCOc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C28H32N4O5S/c1-18(2)27-31-32-28(38-27)30-26(33)22(17-29)15-21-7-9-24(25(16-21)34-5)37-13-11-35-10-12-36-23-8-6-19(3)20(4)14-23/h6-9,14-16,18H,10-13H2,1-5H3,(H,30,32,33)/b22-15- |
| InChIKey | GLFVHNWMFDIFNC-JCMHNJIXSA-N |
| XLogP | 5.31 |
| TPSA | 115.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|