C28H37N5O4S — CID 143085832
N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-cyanoacetamide;4-[3-(2,6-dimethylphenoxy)propoxy]-3-methoxy-N-methylaniline (PubChem CID 143085832) has the molecular formula C28H37N5O4S and a molecular weight of 539.70 g/mol. Its IUPAC name is N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-cyanoacetamide;4-[3-(2,6-dimethylphenoxy)propoxy]-3-methoxy-N-methylaniline.
| Compound Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-cyanoacetamide;4-[3-(2,6-dimethylphenoxy)propoxy]-3-methoxy-N-methylaniline |
|---|---|
| PubChem CID | 143085832 |
| Molecular Formula | C28H37N5O4S |
| Molecular Weight | 539.70 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-2-cyanoacetamide;4-[3-(2,6-dimethylphenoxy)propoxy]-3-methoxy-N-methylaniline |
| SMILES | CC(C)(C)c1nnc(NC(=O)CC#N)s1.CNc1ccc(OCCCOc2c(C)cccc2C)c(OC)c1 |
| InChI | InChI=1S/C19H25NO3.C9H12N4OS/c1-14-7-5-8-15(2)19(14)23-12-6-11-22-17-10-9-16(20-3)13-18(17)21-4;1-9(2,3)7-12-13-8(15-7)11-6(14)4-5-10/h5,7-10,13,20H,6,11-12H2,1-4H3;4H2,1-3H3,(H,11,13,14) |
| InChIKey | FWCSWSIDOMMBPN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|