C20H13F2N3OS — CID 1190864
(E)-2-cyano-3-(4-fluorophenyl)-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 1190864) has the molecular formula C20H13F2N3OS and a molecular weight of 381.41 g/mol. Its IUPAC name is (E)-2-cyano-3-(4-fluorophenyl)-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(4-fluorophenyl)-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 1190864 |
| Molecular Formula | C20H13F2N3OS |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | (E)-2-cyano-3-(4-fluorophenyl)-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(F)cc1)C(=O)Nc1ncc(Cc2ccc(F)cc2)s1 |
| InChI | InChI=1S/C20H13F2N3OS/c21-16-5-1-13(2-6-16)9-15(11-23)19(26)25-20-24-12-18(27-20)10-14-3-7-17(22)8-4-14/h1-9,12H,10H2,(H,24,25,26)/b15-9+ |
| InChIKey | GNJHHFKNYRKZIK-OQLLNIDSSA-N |
| XLogP | 4.56 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|