C27H28FN3O2S — CID 3533638
2-cyano-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-3-(4-heptoxyphenyl)prop-2-enamide (PubChem CID 3533638) has the molecular formula C27H28FN3O2S and a molecular weight of 477.61 g/mol. Its IUPAC name is 2-cyano-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-3-(4-heptoxyphenyl)prop-2-enamide.
| Compound Name | 2-cyano-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-3-(4-heptoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3533638 |
| Molecular Formula | C27H28FN3O2S |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 2-cyano-N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-3-(4-heptoxyphenyl)prop-2-enamide |
| SMILES | CCCCCCCOc1ccc(C=C(C#N)C(=O)Nc2ncc(Cc3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C27H28FN3O2S/c1-2-3-4-5-6-15-33-24-13-9-20(10-14-24)16-22(18-29)26(32)31-27-30-19-25(34-27)17-21-7-11-23(28)12-8-21/h7-14,16,19H,2-6,15,17H2,1H3,(H,30,31,32) |
| InChIKey | YZGUNJXSOKVMID-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|