C20H14ClN3OS — CID 1180772
(E)-N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-cyano-3-phenylprop-2-enamide (PubChem CID 1180772) has the molecular formula C20H14ClN3OS and a molecular weight of 379.87 g/mol. Its IUPAC name is (E)-N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-cyano-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-cyano-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 1180772 |
| Molecular Formula | C20H14ClN3OS |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | (E)-N-[5-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-cyano-3-phenylprop-2-enamide |
| SMILES | N#C/C(=C\c1ccccc1)C(=O)Nc1ncc(Cc2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C20H14ClN3OS/c21-17-8-4-7-15(10-17)11-18-13-23-20(26-18)24-19(25)16(12-22)9-14-5-2-1-3-6-14/h1-10,13H,11H2,(H,23,24,25)/b16-9+ |
| InChIKey | XDELEMJXYFPSFK-CXUHLZMHSA-N |
| XLogP | 4.93 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|