C28H22ClN3O2S — CID 2063045
(E)-N-[5-[(3-chloro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 2063045) has the molecular formula C28H22ClN3O2S and a molecular weight of 500.02 g/mol. Its IUPAC name is (E)-N-[5-[(3-chloro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-[(3-chloro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2063045 |
| Molecular Formula | C28H22ClN3O2S |
| Molecular Weight | 500.02 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | (E)-N-[5-[(3-chloro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-cyano-3-(4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | Cc1ccc(Cc2cnc(NC(=O)/C(C#N)=C/c3ccc(OCc4ccccc4)cc3)s2)cc1Cl |
| InChI | InChI=1S/C28H22ClN3O2S/c1-19-7-8-22(15-26(19)29)14-25-17-31-28(35-25)32-27(33)23(16-30)13-20-9-11-24(12-10-20)34-18-21-5-3-2-4-6-21/h2-13,15,17H,14,18H2,1H3,(H,31,32,33)/b23-13+ |
| InChIKey | BLYKEMMNZJPWGN-YDZHTSKRSA-N |
| XLogP | 6.82 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.02 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|