C29H24ClN3O3S — CID 2063057
(E)-N-[5-[(3-chloro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-cyano-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 2063057) has the molecular formula C29H24ClN3O3S and a molecular weight of 530.05 g/mol. Its IUPAC name is (E)-N-[5-[(3-chloro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-cyano-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-[(3-chloro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-cyano-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2063057 |
| Molecular Formula | C29H24ClN3O3S |
| Molecular Weight | 530.05 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | (E)-N-[5-[(3-chloro-4-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-cyano-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2ncc(Cc3ccc(C)c(Cl)c3)s2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C29H24ClN3O3S/c1-19-8-9-22(14-25(19)30)13-24-17-32-29(37-24)33-28(34)23(16-31)12-21-10-11-26(27(15-21)35-2)36-18-20-6-4-3-5-7-20/h3-12,14-15,17H,13,18H2,1-2H3,(H,32,33,34)/b23-12+ |
| InChIKey | FTQKDMRJCOWUNN-FSJBWODESA-N |
| XLogP | 6.83 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.05 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|