C26H24F3N3O3S — CID 3991305
3-(4-butoxy-3-methoxyphenyl)-2-cyano-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 3991305) has the molecular formula C26H24F3N3O3S and a molecular weight of 515.56 g/mol. Its IUPAC name is 3-(4-butoxy-3-methoxyphenyl)-2-cyano-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(4-butoxy-3-methoxyphenyl)-2-cyano-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3991305 |
| Molecular Formula | C26H24F3N3O3S |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 3-(4-butoxy-3-methoxyphenyl)-2-cyano-N-[5-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | CCCCOc1ccc(C=C(C#N)C(=O)Nc2ncc(Cc3cccc(C(F)(F)F)c3)s2)cc1OC |
| InChI | InChI=1S/C26H24F3N3O3S/c1-3-4-10-35-22-9-8-18(14-23(22)34-2)11-19(15-30)24(33)32-25-31-16-21(36-25)13-17-6-5-7-20(12-17)26(27,28)29/h5-9,11-12,14,16H,3-4,10,13H2,1-2H3,(H,31,32,33) |
| InChIKey | HHYNEHCLEFYRPD-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|