C28H21Cl2N3O3S — CID 2063050
(E)-2-cyano-N-[5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 2063050) has the molecular formula C28H21Cl2N3O3S and a molecular weight of 550.47 g/mol. Its IUPAC name is (E)-2-cyano-N-[5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-[5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2063050 |
| Molecular Formula | C28H21Cl2N3O3S |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | (E)-2-cyano-N-[5-[(2,3-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2ncc(Cc3cccc(Cl)c3Cl)s2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H21Cl2N3O3S/c1-35-25-13-19(10-11-24(25)36-17-18-6-3-2-4-7-18)12-21(15-31)27(34)33-28-32-16-22(37-28)14-20-8-5-9-23(29)26(20)30/h2-13,16H,14,17H2,1H3,(H,32,33,34)/b21-12+ |
| InChIKey | YWZQNXYBJCBCTB-CIAFOILYSA-N |
| XLogP | 7.17 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|