C15H16F2N4OS — CID 39891630
1-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(2,4-difluorophenyl)urea (PubChem CID 39891630) has the molecular formula C15H16F2N4OS and a molecular weight of 338.38 g/mol. Its IUPAC name is 1-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(2,4-difluorophenyl)urea.
| Compound Name | 1-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(2,4-difluorophenyl)urea |
|---|---|
| PubChem CID | 39891630 |
| Molecular Formula | C15H16F2N4OS |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-(5-cyclohexyl-1,3,4-thiadiazol-2-yl)-3-(2,4-difluorophenyl)urea |
| SMILES | O=C(Nc1nnc(C2CCCCC2)s1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H16F2N4OS/c16-10-6-7-12(11(17)8-10)18-14(22)19-15-21-20-13(23-15)9-4-2-1-3-5-9/h6-9H,1-5H2,(H2,18,19,21,22) |
| InChIKey | UEHUDRSTHBVJGB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |